Material Name: | Mg-STA-7 | ||||
Chemical Formula: |
|(HMHACO)1.96 (H2O)7 | [Mg4.8Al19.2P24O96]-SAV HMHACO = C18H42N6 = hexamethylhexacyclen = 1,4,7,10,13,16-hexamethyl-1,4,7,10,13,16-hexazacyclooctadecane SMILES: CN1CCN(CCN(CCN(CCN(CCN(CC1)C)C)C)C)C Images: stick ![]() |
||||
Unit Cell: |
tetragonal |
P 4/n (# 85) |
|||
a' = 18.7730 Å | b' = 18.7730 Å | c' = 9.4540 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
Framework Density: |
14.4 T/1000 Å3 |
|
Channels: |
<100> 8 3.8 x 3.8** <-> [001] 8 3.9 x 3.9*
|
|
Name and Code derivation: |
||
University of Saint Andrews - seven | Mg-STA-7 (seven) SAV |
Limiting Rings | |
![]() |
![]() |
8-ring viewed along <100> | 8-ring viewed along [001] |