Material Name: | JU-60 | ||||
Chemical Formula: |
|(DACH)x/2(H2O)y| [MgxAl30-xP30O120 ]-JSY (x ~ 6) DACH = C6H14N2 = 1,2-diaminocyclohexane = cyclohexane-1,2-diamine SMILES: C1CCC(C(C1)N)N Images: stick ![]() |
||||
Unit Cell: |
hexagonal |
P 63/m (# 176) |
|||
a' = 13.4659 Å | b' = 13.4659 Å | c' = 25.7583 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
Framework Density: |
14.8 T/1000 Å3 |
|
Channels: |
|
References: |
||||
Li,Y., Li, X., Liu, J., Duan, F. and Yu, J. | ||||
"In silico prediction and screening of modular crystal structures via a high-throughput genomic approach" | ||||
Nat Commun, 6, 8328 (2015) | ||||
Shi, J., Hu, J., Qinming Wu, Q., Chen, W., Dong, Z., Zheng, A., Ma, Y., Meng, X., and Xiao F-S. | ||||
"A Six-Membered Ring Molecular Sieve Achieved by a Reconstruction Route" | ||||
J. Am. Chem. Soc., 145, 7712−7717 (2023) | ||||
Material name: ZJM-8, as-made | ||||
Chemical formula: |(BTEAB+2)3.5 (H2O)2.8| [Al30P30O120(OH)6]-JSY (1) BTEAB+2 = C16H38N2+2 = 1,4-bis(triethylammonium)butane = triethyl-[4-(triethylazaniumyl)butyl]azanium SMILES: CC[N+](CC)(CC)CCCC[N+](CC)(CC)CC Images: stick ![]() |
|
Name and Code derivation: |
|
Chemistry, Jilin University - sixty JU-60 (sixty) JSY |
(1) | Contains pentacoordinated Al (to possibly compensate the charge of the OSDA) |
Limiting Rings | |
![]() |
|
8-ring viewed along [100] |