*SSZ-61, as-made | ||||
Smeets, S., Xie, D., Baerlocher, Ch., McCusker, L.B., Wan, W., Zou, X. and Zones, S.I. High-Silica Zeolite SSZ-61 with Dumbbell-Shaped Extra-Large-Pore Channels Angew. Chem. Int. Ed., 53, 10398-10402 (2014) |
|(DEAT+)4| [Si80O158(OH)4]--SSO DEAT+ = C16H26N+ = 8-azonia-8,8-diethyltetracyclo[4.3.3.1^2,5.01,6]tridec-3-ene ion = 8,8-Diethyl-8-azoniatetracyclo[4.3.3.12,5.01,6]tridec-3-ene SMILES: CC[N+]1(CC23CCCC2(C1)C4CC3C=C4)CC Images: stick ![]() XRD pattern: as-made SSZ-61 |
Search for more -SSO references with Google Scholar |
* | The Reference Material is indicated with an asterisk (*). |